About 2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid
2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid (PubChem CID 66601963) has the molecular formula C21H22ClN3O3
and a molecular weight of 399.88 g/mol. Its IUPAC name is 2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid.
Molecular Properties
| Compound Name | 2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid |
| PubChem CID | 66601963 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid |
| SMILES | CCC(C(=O)O)C1CN(C2=Nc3ccccc3Oc3ccc(Cl)cc32)CCN1 |
| InChI | InChI=1S/C21H22ClN3O3/c1-2-14(21(26)27)17-12-25(10-9-23-17)20-15-11-13(22)7-8-18(15)28-19-6-4-3-5-16(19)24-20/h3-8,11,14,17,23H,2,9-10,12H2,1H3,(H,26,27) |
| InChIKey | NWHANGAOSVVISB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid?
The IUPAC name of 2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid (CID 66601963) is 2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid.
What is the SMILES notation for 2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid?
The canonical SMILES for 2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid is CCC(C(=O)O)C1CN(C2=Nc3ccccc3Oc3ccc(Cl)cc32)CCN1.
What is the InChIKey of 2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid?
The InChIKey is NWHANGAOSVVISB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClN3O3/c1-2-14(21(26)27)17-12-25(10-9-23-17)20-15-11-13(22)7-8-18(15)28-19-6-4-3-5-16(19)24-20/h3-8,11,14,17,23H,2,9-10,12H2,1H3,(H,26,27).
What are the key properties of 2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid?
2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid has a molecular weight of 399.88 g/mol, XLogP of 3.91, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-2-yl]butanoic acid is sourced from PubChem (CID 66601963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).