About 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid
4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid (PubChem CID 89279711) has the molecular formula C22H22ClN3O3
and a molecular weight of 411.89 g/mol. Its IUPAC name is 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid.
Molecular Properties
| Compound Name | 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid |
| PubChem CID | 89279711 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid |
| SMILES | C=C(CCN1CCN(C2=Nc3ccccc3Oc3ccc(Cl)cc32)CC1)C(=O)O |
| InChI | InChI=1S/C22H22ClN3O3/c1-15(22(27)28)8-9-25-10-12-26(13-11-25)21-17-14-16(23)6-7-19(17)29-20-5-3-2-4-18(20)24-21/h2-7,14H,1,8-13H2,(H,27,28) |
| InChIKey | PLQHXUHXEDCDER-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid?
The IUPAC name of 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid (CID 89279711) is 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid.
What is the SMILES notation for 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid?
The canonical SMILES for 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid is C=C(CCN1CCN(C2=Nc3ccccc3Oc3ccc(Cl)cc32)CC1)C(=O)O.
What is the InChIKey of 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid?
The InChIKey is PLQHXUHXEDCDER-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22ClN3O3/c1-15(22(27)28)8-9-25-10-12-26(13-11-25)21-17-14-16(23)6-7-19(17)29-20-5-3-2-4-18(20)24-21/h2-7,14H,1,8-13H2,(H,27,28).
What are the key properties of 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid?
4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid has a molecular weight of 411.89 g/mol, XLogP of 4.17, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-methylidenebutanoic acid is sourced from PubChem (CID 89279711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).