C18H18ClN5O — CID 58770136
4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazine-1-carboximidamide (PubChem CID 58770136) has the molecular formula C18H18ClN5O and a molecular weight of 355.83 g/mol. Its IUPAC name is 4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazine-1-carboximidamide.
| Compound Name | 4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 58770136 |
| Molecular Formula | C18H18ClN5O |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCN(C2=Nc3ccccc3Oc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C18H18ClN5O/c19-12-5-6-15-13(11-12)17(22-14-3-1-2-4-16(14)25-15)23-7-9-24(10-8-23)18(20)21/h1-6,11H,7-10H2,(H3,20,21) |
| InChIKey | ZKBODXHUTKATDR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|