C30H26ClN7O4 — CID 123591839
1-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-[7-[ethenyl-(methylideneamino)amino]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione (PubChem CID 123591839) has the molecular formula C30H26ClN7O4 and a molecular weight of 584.04 g/mol. Its IUPAC name is 1-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-[7-[ethenyl-(methylideneamino)amino]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-[7-[ethenyl-(methylideneamino)amino]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 123591839 |
| Molecular Formula | C30H26ClN7O4 |
| Molecular Weight | 584.04 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | 1-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]-2-[7-[ethenyl-(methylideneamino)amino]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
| SMILES | C=CN(N=C)c1ncc(OC)c2c(C(=O)C(=O)N3CCN(C4=Nc5ccccc5Oc5ccc(Cl)cc54)CC3)c[nH]c12 |
| InChI | InChI=1S/C30H26ClN7O4/c1-4-38(32-2)29-26-25(24(41-3)17-34-29)20(16-33-26)27(39)30(40)37-13-11-36(12-14-37)28-19-15-18(31)9-10-22(19)42-23-8-6-5-7-21(23)35-28/h4-10,15-17,33H,1-2,11-14H2,3H3 |
| InChIKey | MGSXHCQMDUFXSE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.04 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|