C23H20ClN5O3 — CID 74370997
3-[4-[2-(7-chloro-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-oxoacetyl]piperazin-1-yl]-3-phenylprop-2-enenitrile (PubChem CID 74370997) has the molecular formula C23H20ClN5O3 and a molecular weight of 449.90 g/mol. Its IUPAC name is 3-[4-[2-(7-chloro-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-oxoacetyl]piperazin-1-yl]-3-phenylprop-2-enenitrile.
| Compound Name | 3-[4-[2-(7-chloro-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-oxoacetyl]piperazin-1-yl]-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 74370997 |
| Molecular Formula | C23H20ClN5O3 |
| Molecular Weight | 449.90 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 3-[4-[2-(7-chloro-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-oxoacetyl]piperazin-1-yl]-3-phenylprop-2-enenitrile |
| SMILES | COc1cnc(Cl)c2[nH]cc(C(=O)C(=O)N3CCN(C(=CC#N)c4ccccc4)CC3)c12 |
| InChI | InChI=1S/C23H20ClN5O3/c1-32-18-14-27-22(24)20-19(18)16(13-26-20)21(30)23(31)29-11-9-28(10-12-29)17(7-8-25)15-5-3-2-4-6-15/h2-7,13-14,26H,9-12H2,1H3 |
| InChIKey | NXQPSEFTJMNWTB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.90 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|