C31H27N3O4 — CID 5279926
1-(4,7-dimethoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-[4-(1,3-diphenylprop-2-ynylidene)piperidin-1-yl]ethane-1,2-dione (PubChem CID 5279926) has the molecular formula C31H27N3O4 and a molecular weight of 505.57 g/mol. Its IUPAC name is 1-(4,7-dimethoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-[4-(1,3-diphenylprop-2-ynylidene)piperidin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(4,7-dimethoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-[4-(1,3-diphenylprop-2-ynylidene)piperidin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 5279926 |
| Molecular Formula | C31H27N3O4 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 1-(4,7-dimethoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-[4-(1,3-diphenylprop-2-ynylidene)piperidin-1-yl]ethane-1,2-dione |
| SMILES | COc1ncc(OC)c2c(C(=O)C(=O)N3CCC(=C(C#Cc4ccccc4)c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C31H27N3O4/c1-37-26-20-33-30(38-2)28-27(26)25(19-32-28)29(35)31(36)34-17-15-23(16-18-34)24(22-11-7-4-8-12-22)14-13-21-9-5-3-6-10-21/h3-12,19-20,32H,15-18H2,1-2H3 |
| InChIKey | LBXBVHAILDVZGA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|