C28H27N7O3Y-2 — CID 167407516
CID 167407516 (PubChem CID 167407516) has the molecular formula C28H27N7O3Y-2 and a molecular weight of 598.48 g/mol.
| Compound Name | CID 167407516 |
|---|---|
| PubChem CID | 167407516 |
| Molecular Formula | C28H27N7O3Y-2 |
| Molecular Weight | 598.48 g/mol |
| Exact Mass | 598.12 |
| IUPAC Name | — |
| SMILES | COc1cnc(-n2cn[c-]n2)c2[nH]cc(C(=O)C(=O)N3CCC(=C(C#N)c4ccccc4)CC3)c12.C[CH-]C.[Y] |
| InChI | InChI=1S/C25H20N7O3.C3H7.Y/c1-35-20-13-29-24(32-15-27-14-30-32)22-21(20)19(12-28-22)23(33)25(34)31-9-7-17(8-10-31)18(11-26)16-5-3-2-4-6-16;1-3-2;/h2-6,12-13,15,28H,7-10H2,1H3;3H,1-2H3;/q2*-1; |
| InChIKey | LASDQPRTAOJNOL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 129.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|