C24H23N6O4Y- — CID 155742906
CID 155742906 (PubChem CID 155742906) has the molecular formula C24H23N6O4Y- and a molecular weight of 548.39 g/mol.
| Compound Name | CID 155742906 |
|---|---|
| PubChem CID | 155742906 |
| Molecular Formula | C24H23N6O4Y- |
| Molecular Weight | 548.39 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | — |
| SMILES | COc1cnc(-n2cn[c-]n2)c2[nH]cc(C(=O)C(=O)N3CC(CCC(=O)c4ccccc4)C3)c12.[H][H].[Y] |
| InChI | InChI=1S/C24H21N6O4.Y.H2/c1-34-19-10-27-23(30-14-25-13-28-30)21-20(19)17(9-26-21)22(32)24(33)29-11-15(12-29)7-8-18(31)16-5-3-2-4-6-16;;/h2-6,9-10,14-15,26H,7-8,11-12H2,1H3;;1H/q-1;; |
| InChIKey | YVAPHKOHXVSKPD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|