C28H25N7O2 — CID 142894806
2-[1-[3-[7-(2-aminopyrimidin-5-yl)-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-3-oxoprop-1-en-2-yl]piperidin-4-ylidene]-2-phenylacetonitrile (PubChem CID 142894806) has the molecular formula C28H25N7O2 and a molecular weight of 491.56 g/mol. Its IUPAC name is 2-[1-[3-[7-(2-aminopyrimidin-5-yl)-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-3-oxoprop-1-en-2-yl]piperidin-4-ylidene]-2-phenylacetonitrile.
| Compound Name | 2-[1-[3-[7-(2-aminopyrimidin-5-yl)-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-3-oxoprop-1-en-2-yl]piperidin-4-ylidene]-2-phenylacetonitrile |
|---|---|
| PubChem CID | 142894806 |
| Molecular Formula | C28H25N7O2 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 2-[1-[3-[7-(2-aminopyrimidin-5-yl)-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-3-oxoprop-1-en-2-yl]piperidin-4-ylidene]-2-phenylacetonitrile |
| SMILES | C=C(C(=O)c1c[nH]c2c(-c3cnc(N)nc3)ncc(OC)c12)N1CCC(=C(C#N)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H25N7O2/c1-17(35-10-8-19(9-11-35)21(12-29)18-6-4-3-5-7-18)27(36)22-15-31-26-24(22)23(37-2)16-32-25(26)20-13-33-28(30)34-14-20/h3-7,13-16,31H,1,8-11H2,2H3,(H2,30,33,34) |
| InChIKey | BDAYYWQHSQEWNM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 133.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|