C23H26ClN3O3 — CID 19004079
ethyl 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]butanoate (PubChem CID 19004079) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is ethyl 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]butanoate.
| Compound Name | ethyl 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 19004079 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | ethyl 4-[4-(8-chlorobenzo[b][1,4]benzoxazepin-6-yl)piperazin-1-yl]butanoate |
| SMILES | CCOC(=O)CCCN1CCN(C2=Nc3ccccc3Oc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C23H26ClN3O3/c1-2-29-22(28)8-5-11-26-12-14-27(15-13-26)23-18-16-17(24)9-10-20(18)30-21-7-4-3-6-19(21)25-23/h3-4,6-7,9-10,16H,2,5,8,11-15H2,1H3 |
| InChIKey | GHYZZUDWBSVYDJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |