C19H21ClIN3O — CID 163322107
8-chloro-6-(2,2,3,3,5,5,6,6-octadeuterio-4,4-dimethylpiperazin-4-ium-1-yl)benzo[b][1,4]benzoxazepine iodide (PubChem CID 163322107) has the molecular formula C19H21ClIN3O and a molecular weight of 477.80 g/mol. Its IUPAC name is 8-chloro-6-(2,2,3,3,5,5,6,6-octadeuterio-4,4-dimethylpiperazin-4-ium-1-yl)benzo[b][1,4]benzoxazepine iodide.
| Compound Name | 8-chloro-6-(2,2,3,3,5,5,6,6-octadeuterio-4,4-dimethylpiperazin-4-ium-1-yl)benzo[b][1,4]benzoxazepine iodide |
|---|---|
| PubChem CID | 163322107 |
| Molecular Formula | C19H21ClIN3O |
| Molecular Weight | 477.80 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 8-chloro-6-(2,2,3,3,5,5,6,6-octadeuterio-4,4-dimethylpiperazin-4-ium-1-yl)benzo[b][1,4]benzoxazepine iodide |
| SMILES | [2H]C1([2H])N(C2=Nc3ccccc3Oc3ccc(Cl)cc32)C([2H])([2H])C([2H])([2H])[N+](C)(C)C1([2H])[2H].[I-] |
| InChI | InChI=1S/C19H21ClN3O.HI/c1-23(2)11-9-22(10-12-23)19-15-13-14(20)7-8-17(15)24-18-6-4-3-5-16(18)21-19;/h3-8,13H,9-12H2,1-2H3;1H/q+1;/p-1/i9D2,10D2,11D2,12D2; |
| InChIKey | QFIXNGQYIYEVTD-QPUNNWGTSA-M |
| XLogP | 0.92 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.80 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|