C52H36N4O — CID 163498747
3-dibenzofuran-4-yl-9-[(3E,5Z)-3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]hepta-1,3,5-trien-2-yl]carbazole (PubChem CID 163498747) has the molecular formula C52H36N4O and a molecular weight of 732.89 g/mol. Its IUPAC name is 3-dibenzofuran-4-yl-9-[(3E,5Z)-3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]hepta-1,3,5-trien-2-yl]carbazole.
| Compound Name | 3-dibenzofuran-4-yl-9-[(3E,5Z)-3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]hepta-1,3,5-trien-2-yl]carbazole |
|---|---|
| PubChem CID | 163498747 |
| Molecular Formula | C52H36N4O |
| Molecular Weight | 732.89 g/mol |
| Exact Mass | 732.29 |
| IUPAC Name | 3-dibenzofuran-4-yl-9-[(3E,5Z)-3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]hepta-1,3,5-trien-2-yl]carbazole |
| SMILES | C=C(/C(=C\C=C/C)c1nc(-c2ccccc2)nc(-c2ccc(-c3ccccc3)cc2)n1)n1c2ccccc2c2cc(-c3cccc4c3oc3ccccc34)ccc21 |
| InChI | InChI=1S/C52H36N4O/c1-3-4-20-40(52-54-50(37-18-9-6-10-19-37)53-51(55-52)38-29-27-36(28-30-38)35-16-7-5-8-17-35)34(2)56-46-25-13-11-21-42(46)45-33-39(31-32-47(45)56)41-23-15-24-44-43-22-12-14-26-48(43)57-49(41)44/h3-33H,2H2,1H3/b4-3-,40-20+ |
| InChIKey | CSXOTESJGYWQJO-BXFAIVDQSA-N |
| XLogP | 13.68 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.89 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|