C17H27NO3 — CID 163500884
methyl 1-[[(2R,3E,5Z)-2,3-dimethylhepta-3,5-dienoyl]amino]cyclohexane-1-carboxylate (PubChem CID 163500884) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is methyl 1-[[(2R,3E,5Z)-2,3-dimethylhepta-3,5-dienoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[[(2R,3E,5Z)-2,3-dimethylhepta-3,5-dienoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 163500884 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | methyl 1-[[(2R,3E,5Z)-2,3-dimethylhepta-3,5-dienoyl]amino]cyclohexane-1-carboxylate |
| SMILES | C/C=C\C=C(/C)[C@@H](C)C(=O)NC1(C(=O)OC)CCCCC1 |
| InChI | InChI=1S/C17H27NO3/c1-5-6-10-13(2)14(3)15(19)18-17(16(20)21-4)11-8-7-9-12-17/h5-6,10,14H,7-9,11-12H2,1-4H3,(H,18,19)/b6-5-,13-10+/t14-/m1/s1 |
| InChIKey | CUPIFKHTEDLWNS-SBYUHPNGSA-N |
| XLogP | 3.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|