C23H29F3IN5O4S — CID 163501944
methyl 2-[[1-[[5-methyl-3-[3-methyl-3-(methylidene-λ3-iodanyl)cyclobutyl]-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]-4,5-dihydroimidazol-2-yl]amino]acetate (PubChem CID 163501944) has the molecular formula C23H29F3IN5O4S and a molecular weight of 655.48 g/mol. Its IUPAC name is methyl 2-[[1-[[5-methyl-3-[3-methyl-3-(methylidene-λ3-iodanyl)cyclobutyl]-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]-4,5-dihydroimidazol-2-yl]amino]acetate.
| Compound Name | methyl 2-[[1-[[5-methyl-3-[3-methyl-3-(methylidene-λ3-iodanyl)cyclobutyl]-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]-4,5-dihydroimidazol-2-yl]amino]acetate |
|---|---|
| PubChem CID | 163501944 |
| Molecular Formula | C23H29F3IN5O4S |
| Molecular Weight | 655.48 g/mol |
| Exact Mass | 655.09 |
| IUPAC Name | methyl 2-[[1-[[5-methyl-3-[3-methyl-3-(methylidene-λ3-iodanyl)cyclobutyl]-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]-4,5-dihydroimidazol-2-yl]amino]acetate |
| SMILES | C=IC1(C)CC(n2c(=O)c3c(C)c(CN4CCN=C4NCC(=O)OC)sc3n(CCC(F)(F)F)c2=O)C1 |
| InChI | InChI=1S/C23H29F3IN5O4S/c1-13-15(12-30-8-6-28-20(30)29-11-16(33)36-4)37-19-17(13)18(34)32(14-9-22(2,10-14)27-3)21(35)31(19)7-5-23(24,25)26/h14H,3,5-12H2,1-2,4H3,(H,28,29) |
| InChIKey | CVMWNAONOFALEH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 97.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|