C29H36N2O3S — CID 163502234
5-[2-(4-butylphenyl)sulfonylethyl]-3-(2-methoxyphenyl)-1-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]pyrazole (PubChem CID 163502234) has the molecular formula C29H36N2O3S and a molecular weight of 492.69 g/mol. Its IUPAC name is 5-[2-(4-butylphenyl)sulfonylethyl]-3-(2-methoxyphenyl)-1-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]pyrazole.
| Compound Name | 5-[2-(4-butylphenyl)sulfonylethyl]-3-(2-methoxyphenyl)-1-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]pyrazole |
|---|---|
| PubChem CID | 163502234 |
| Molecular Formula | C29H36N2O3S |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 5-[2-(4-butylphenyl)sulfonylethyl]-3-(2-methoxyphenyl)-1-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]pyrazole |
| SMILES | C/C=C(C)\C(=C/C)n1nc(-c2ccccc2OC)cc1CCS(=O)(=O)c1ccc(CCCC)cc1 |
| InChI | InChI=1S/C29H36N2O3S/c1-6-9-12-23-15-17-25(18-16-23)35(32,33)20-19-24-21-27(26-13-10-11-14-29(26)34-5)30-31(24)28(8-3)22(4)7-2/h7-8,10-11,13-18,21H,6,9,12,19-20H2,1-5H3/b22-7-,28-8+ |
| InChIKey | CVTIOAFWXCSUME-VXNGZZAXSA-N |
| XLogP | 6.74 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|