C29H36ClFN6O3 — CID 163502288
6-chloro-3-[[[4-[[4-[3-(4-fluorophenyl)-2-oxo-1-propan-2-ylimidazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]amino]methyl]-2-oxohexanal (PubChem CID 163502288) has the molecular formula C29H36ClFN6O3 and a molecular weight of 571.10 g/mol. Its IUPAC name is 6-chloro-3-[[[4-[[4-[3-(4-fluorophenyl)-2-oxo-1-propan-2-ylimidazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]amino]methyl]-2-oxohexanal.
| Compound Name | 6-chloro-3-[[[4-[[4-[3-(4-fluorophenyl)-2-oxo-1-propan-2-ylimidazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]amino]methyl]-2-oxohexanal |
|---|---|
| PubChem CID | 163502288 |
| Molecular Formula | C29H36ClFN6O3 |
| Molecular Weight | 571.10 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 6-chloro-3-[[[4-[[4-[3-(4-fluorophenyl)-2-oxo-1-propan-2-ylimidazol-4-yl]pyrimidin-2-yl]amino]cyclohexyl]amino]methyl]-2-oxohexanal |
| SMILES | CC(C)n1cc(-c2ccnc(NC3CCC(NCC(CCCCl)C(=O)C=O)CC3)n2)n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C29H36ClFN6O3/c1-19(2)36-17-26(37(29(36)40)24-11-5-21(31)6-12-24)25-13-15-32-28(35-25)34-23-9-7-22(8-10-23)33-16-20(4-3-14-30)27(39)18-38/h5-6,11-13,15,17-20,22-23,33H,3-4,7-10,14,16H2,1-2H3,(H,32,34,35) |
| InChIKey | CVUDFPVSPHJTKT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.10 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|