C20H21N5OS — CID 163503607
N-[5-[2-[4-(dimethylamino)anilino]-4-pyridinyl]-4-methyl-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 163503607) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is N-[5-[2-[4-(dimethylamino)anilino]-4-pyridinyl]-4-methyl-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | N-[5-[2-[4-(dimethylamino)anilino]-4-pyridinyl]-4-methyl-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 163503607 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[5-[2-[4-(dimethylamino)anilino]-4-pyridinyl]-4-methyl-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1nc(C)c(-c2ccnc(Nc3ccc(N(C)C)cc3)c2)s1 |
| InChI | InChI=1S/C20H21N5OS/c1-5-18(26)24-20-22-13(2)19(27-20)14-10-11-21-17(12-14)23-15-6-8-16(9-7-15)25(3)4/h5-12H,1H2,2-4H3,(H,21,23)(H,22,24,26) |
| InChIKey | CWTIWPAXDASRFO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|