C12H17N5 — CID 163507784
4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine (PubChem CID 163507784) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine |
|---|---|
| PubChem CID | 163507784 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine |
| SMILES | C1=CC(C2(c3nn[nH]n3)CCNCC2)=CCC1 |
| InChI | InChI=1S/C12H17N5/c1-2-4-10(5-3-1)12(6-8-13-9-7-12)11-14-16-17-15-11/h2,4-5,13H,1,3,6-9H2,(H,14,15,16,17) |
| InChIKey | DAABBWOEEZNFCC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |