About 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine
4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine (PubChem CID 163507784) has the molecular formula C12H17N5
and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine.
Molecular Properties
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine |
| PubChem CID | 163507784 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine |
| SMILES | C1=CC(C2(c3nn[nH]n3)CCNCC2)=CCC1 |
| InChI | InChI=1S/C12H17N5/c1-2-4-10(5-3-1)12(6-8-13-9-7-12)11-14-16-17-15-11/h2,4-5,13H,1,3,6-9H2,(H,14,15,16,17) |
| InChIKey | DAABBWOEEZNFCC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine?
The IUPAC name of 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine (CID 163507784) is 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine.
What is the SMILES notation for 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine?
The canonical SMILES for 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine is C1=CC(C2(c3nn[nH]n3)CCNCC2)=CCC1.
What is the InChIKey of 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine?
The InChIKey is DAABBWOEEZNFCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5/c1-2-4-10(5-3-1)12(6-8-13-9-7-12)11-14-16-17-15-11/h2,4-5,13H,1,3,6-9H2,(H,14,15,16,17).
What are the key properties of 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine?
4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine has a molecular weight of 231.30 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-1,5-dien-1-yl-4-(2H-tetrazol-5-yl)piperidine is sourced from PubChem (CID 163507784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).