C13H22N2 — CID 142035450
(3-cyclohexa-1,5-dien-1-ylpyrrolidin-3-yl)methanimine;ethane (PubChem CID 142035450) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is (3-cyclohexa-1,5-dien-1-ylpyrrolidin-3-yl)methanimine;ethane.
| Compound Name | (3-cyclohexa-1,5-dien-1-ylpyrrolidin-3-yl)methanimine;ethane |
|---|---|
| PubChem CID | 142035450 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (3-cyclohexa-1,5-dien-1-ylpyrrolidin-3-yl)methanimine;ethane |
| SMILES | CC.[H]/N=C/C1(C2=CCCC=C2)CCNC1 |
| InChI | InChI=1S/C11H16N2.C2H6/c12-8-11(6-7-13-9-11)10-4-2-1-3-5-10;1-2/h2,4-5,8,12-13H,1,3,6-7,9H2;1-2H3/b12-8+; |
| InChIKey | MXQHDECQVISVCE-MXZHIVQLSA-N |
| XLogP | 2.92 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|