C20H33N — CID 145429187
4-cyclohexa-1,5-dien-1-yl-1-(3-methylpentan-2-yl)-4-prop-1-en-2-ylpiperidine (PubChem CID 145429187) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-1-(3-methylpentan-2-yl)-4-prop-1-en-2-ylpiperidine.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-1-(3-methylpentan-2-yl)-4-prop-1-en-2-ylpiperidine |
|---|---|
| PubChem CID | 145429187 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-1-(3-methylpentan-2-yl)-4-prop-1-en-2-ylpiperidine |
| SMILES | C=C(C)C1(C2=CCCC=C2)CCN(C(C)C(C)CC)CC1 |
| InChI | InChI=1S/C20H33N/c1-6-17(4)18(5)21-14-12-20(13-15-21,16(2)3)19-10-8-7-9-11-19/h8,10-11,17-18H,2,6-7,9,12-15H2,1,3-5H3 |
| InChIKey | WQRTXKPUMXFAGP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|