C10H14O2 — CID 163422201
2-cyclohexa-1,5-dien-1-yl-2-methyl-1,3-dioxolane (PubChem CID 163422201) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-2-methyl-1,3-dioxolane.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 163422201 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-2-methyl-1,3-dioxolane |
| SMILES | CC1(C2=CCCC=C2)OCCO1 |
| InChI | InChI=1S/C10H14O2/c1-10(11-7-8-12-10)9-5-3-2-4-6-9/h3,5-6H,2,4,7-8H2,1H3 |
| InChIKey | AJKBXNBBSLKFPC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |