C33H30O8 — CID 91320486
2-cyclohexa-1,5-dien-1-yl-5-[5-(2-cyclohexa-1,5-dien-1-yl-2-methyl-4,6-dioxo-1,3-dioxan-5-ylidene)-3-phenylpent-3-enylidene]-2-methyl-1,3-dioxane-4,6-dione (PubChem CID 91320486) has the molecular formula C33H30O8 and a molecular weight of 554.60 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-5-[5-(2-cyclohexa-1,5-dien-1-yl-2-methyl-4,6-dioxo-1,3-dioxan-5-ylidene)-3-phenylpent-3-enylidene]-2-methyl-1,3-dioxane-4,6-dione.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-5-[5-(2-cyclohexa-1,5-dien-1-yl-2-methyl-4,6-dioxo-1,3-dioxan-5-ylidene)-3-phenylpent-3-enylidene]-2-methyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 91320486 |
| Molecular Formula | C33H30O8 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-5-[5-(2-cyclohexa-1,5-dien-1-yl-2-methyl-4,6-dioxo-1,3-dioxan-5-ylidene)-3-phenylpent-3-enylidene]-2-methyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C2=CCCC=C2)OC(=O)C(=CC=C(CC=C2C(=O)OC(C)(C3=CCCC=C3)OC2=O)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C33H30O8/c1-32(24-14-8-4-9-15-24)38-28(34)26(29(35)39-32)20-18-23(22-12-6-3-7-13-22)19-21-27-30(36)40-33(2,41-31(27)37)25-16-10-5-11-17-25/h3,6-8,10,12-18,20-21H,4-5,9,11,19H2,1-2H3/b23-18?,26-20-,27-21- |
| InChIKey | BZMIVFPBNXWPRR-QSVKGSGSSA-N |
| XLogP | 5.50 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|