C16H13NOS — CID 87276475
(2-cyclohexa-1,5-dien-1-yl-1,3-oxazol-4-yl)-phenylmethanethione (PubChem CID 87276475) has the molecular formula C16H13NOS and a molecular weight of 267.35 g/mol. Its IUPAC name is (2-cyclohexa-1,5-dien-1-yl-1,3-oxazol-4-yl)-phenylmethanethione.
| Compound Name | (2-cyclohexa-1,5-dien-1-yl-1,3-oxazol-4-yl)-phenylmethanethione |
|---|---|
| PubChem CID | 87276475 |
| Molecular Formula | C16H13NOS |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (2-cyclohexa-1,5-dien-1-yl-1,3-oxazol-4-yl)-phenylmethanethione |
| SMILES | S=C(c1ccccc1)c1coc(C2=CCCC=C2)n1 |
| InChI | InChI=1S/C16H13NOS/c19-15(12-7-3-1-4-8-12)14-11-18-16(17-14)13-9-5-2-6-10-13/h1,3-5,7-11H,2,6H2 |
| InChIKey | ZOGDLYKXUGPHOI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|