C24H20O5 — CID 2174504
5-[(4-ethoxynaphthalen-1-yl)methylidene]-2-methyl-2-phenyl-1,3-dioxane-4,6-dione (PubChem CID 2174504) has the molecular formula C24H20O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is 5-[(4-ethoxynaphthalen-1-yl)methylidene]-2-methyl-2-phenyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(4-ethoxynaphthalen-1-yl)methylidene]-2-methyl-2-phenyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 2174504 |
| Molecular Formula | C24H20O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 5-[(4-ethoxynaphthalen-1-yl)methylidene]-2-methyl-2-phenyl-1,3-dioxane-4,6-dione |
| SMILES | CCOc1ccc(C=C2C(=O)OC(C)(c3ccccc3)OC2=O)c2ccccc12 |
| InChI | InChI=1S/C24H20O5/c1-3-27-21-14-13-16(18-11-7-8-12-19(18)21)15-20-22(25)28-24(2,29-23(20)26)17-9-5-4-6-10-17/h4-15H,3H2,1-2H3/b20-15- |
| InChIKey | LNVRIULQONJMEM-HKWRFOASSA-N |
| XLogP | 4.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|