C14H13N5O2 — CID 163509573
2-[[1-(2-methylphenyl)triazol-4-yl]methoxy]pyrimidin-5-ol (PubChem CID 163509573) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-[[1-(2-methylphenyl)triazol-4-yl]methoxy]pyrimidin-5-ol.
| Compound Name | 2-[[1-(2-methylphenyl)triazol-4-yl]methoxy]pyrimidin-5-ol |
|---|---|
| PubChem CID | 163509573 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-[[1-(2-methylphenyl)triazol-4-yl]methoxy]pyrimidin-5-ol |
| SMILES | Cc1ccccc1-n1cc(COc2ncc(O)cn2)nn1 |
| InChI | InChI=1S/C14H13N5O2/c1-10-4-2-3-5-13(10)19-8-11(17-18-19)9-21-14-15-6-12(20)7-16-14/h2-8,20H,9H2,1H3 |
| InChIKey | DBNXTHMVAZGYFA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |