C15H26O2 — CID 163511434
2-(cyclohexen-1-yl)propan-2-yl 2,2-dimethylbutanoate (PubChem CID 163511434) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)propan-2-yl 2,2-dimethylbutanoate.
| Compound Name | 2-(cyclohexen-1-yl)propan-2-yl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 163511434 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-(cyclohexen-1-yl)propan-2-yl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C)(C)C1=CCCCC1 |
| InChI | InChI=1S/C15H26O2/c1-6-14(2,3)13(16)17-15(4,5)12-10-8-7-9-11-12/h10H,6-9,11H2,1-5H3 |
| InChIKey | IVRPOFWJIPQRLV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|