C28H35N4O4+ — CID 163511584
[4-[4-[[4-(2-carboxyethylcarbamoyl)anilino]-cyclohexylmethyl]-3-ethylpyrazol-1-yl]phenyl]oxidanium (PubChem CID 163511584) has the molecular formula C28H35N4O4+ and a molecular weight of 491.61 g/mol. Its IUPAC name is [4-[4-[[4-(2-carboxyethylcarbamoyl)anilino]-cyclohexylmethyl]-3-ethylpyrazol-1-yl]phenyl]oxidanium.
| Compound Name | [4-[4-[[4-(2-carboxyethylcarbamoyl)anilino]-cyclohexylmethyl]-3-ethylpyrazol-1-yl]phenyl]oxidanium |
|---|---|
| PubChem CID | 163511584 |
| Molecular Formula | C28H35N4O4+ |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | [4-[4-[[4-(2-carboxyethylcarbamoyl)anilino]-cyclohexylmethyl]-3-ethylpyrazol-1-yl]phenyl]oxidanium |
| SMILES | CCc1nn(-c2ccc([OH2+])cc2)cc1C(Nc1ccc(C(=O)NCCC(=O)O)cc1)C1CCCCC1 |
| InChI | InChI=1S/C28H34N4O4/c1-2-25-24(18-32(31-25)22-12-14-23(33)15-13-22)27(19-6-4-3-5-7-19)30-21-10-8-20(9-11-21)28(36)29-17-16-26(34)35/h8-15,18-19,27,30,33H,2-7,16-17H2,1H3,(H,29,36)(H,34,35)/p+1 |
| InChIKey | DDDLVLZACSSZPQ-UHFFFAOYSA-O |
| XLogP | 4.81 |
| TPSA | 119.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|