C19H26N4O5 — CID 119223003
3-[[4-[[2-(cyclohexylcarbamoylamino)acetyl]amino]benzoyl]amino]propanoic acid (PubChem CID 119223003) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 3-[[4-[[2-(cyclohexylcarbamoylamino)acetyl]amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[2-(cyclohexylcarbamoylamino)acetyl]amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119223003 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3-[[4-[[2-(cyclohexylcarbamoylamino)acetyl]amino]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(NC(=O)CNC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H26N4O5/c24-16(12-21-19(28)23-14-4-2-1-3-5-14)22-15-8-6-13(7-9-15)18(27)20-11-10-17(25)26/h6-9,14H,1-5,10-12H2,(H,20,27)(H,22,24)(H,25,26)(H2,21,23,28) |
| InChIKey | ZIQWZLAUVIPLCD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |