C26H33N8S+ — CID 163513909
[4-[4-(4-amino-6,7-dimethylimidazo[4,5-c]pyridin-1-yl)butylamino]sulfanylphenyl]imino-[4-(dimethylamino)phenyl]azanium (PubChem CID 163513909) has the molecular formula C26H33N8S+ and a molecular weight of 489.67 g/mol. Its IUPAC name is [4-[4-(4-amino-6,7-dimethylimidazo[4,5-c]pyridin-1-yl)butylamino]sulfanylphenyl]imino-[4-(dimethylamino)phenyl]azanium.
| Compound Name | [4-[4-(4-amino-6,7-dimethylimidazo[4,5-c]pyridin-1-yl)butylamino]sulfanylphenyl]imino-[4-(dimethylamino)phenyl]azanium |
|---|---|
| PubChem CID | 163513909 |
| Molecular Formula | C26H33N8S+ |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | [4-[4-(4-amino-6,7-dimethylimidazo[4,5-c]pyridin-1-yl)butylamino]sulfanylphenyl]imino-[4-(dimethylamino)phenyl]azanium |
| SMILES | Cc1nc(N)c2ncn(CCCCNSc3ccc(/N=[NH+]/c4ccc(N(C)C)cc4)cc3)c2c1C |
| InChI | InChI=1S/C26H32N8S/c1-18-19(2)30-26(27)24-25(18)34(17-28-24)16-6-5-15-29-35-23-13-9-21(10-14-23)32-31-20-7-11-22(12-8-20)33(3)4/h7-14,17,29H,5-6,15-16H2,1-4H3,(H2,27,30)/p+1/b32-31+ |
| InChIKey | DFBFOZXFDGVKHE-QNEJGDQOSA-O |
| XLogP | 4.27 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|