C20H30OS — CID 163517135
1-[(5S)-3-[(1S)-1-(4-methoxyphenyl)butyl]-1-bicyclo[3.1.0]hexanyl]propane-1-thiol (PubChem CID 163517135) has the molecular formula C20H30OS and a molecular weight of 318.53 g/mol. Its IUPAC name is 1-[(5S)-3-[(1S)-1-(4-methoxyphenyl)butyl]-1-bicyclo[3.1.0]hexanyl]propane-1-thiol.
| Compound Name | 1-[(5S)-3-[(1S)-1-(4-methoxyphenyl)butyl]-1-bicyclo[3.1.0]hexanyl]propane-1-thiol |
|---|---|
| PubChem CID | 163517135 |
| Molecular Formula | C20H30OS |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 1-[(5S)-3-[(1S)-1-(4-methoxyphenyl)butyl]-1-bicyclo[3.1.0]hexanyl]propane-1-thiol |
| SMILES | CCC[C@H](c1ccc(OC)cc1)C1C[C@H]2CC2(C(S)CC)C1 |
| InChI | InChI=1S/C20H30OS/c1-4-6-18(14-7-9-17(21-3)10-8-14)15-11-16-13-20(16,12-15)19(22)5-2/h7-10,15-16,18-19,22H,4-6,11-13H2,1-3H3/t15?,16-,18+,19?,20?/m0/s1 |
| InChIKey | DHSCGDSBVMBFEA-FHBNIYBGSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|