C26H34N4O3S — CID 163518005
(2S)-N-[(1S)-3-[4-[3-(2-methoxyethyl)-2-oxo-1,3-benzothiazol-5-yl]phenyl]-1-(methylamino)propyl]piperidine-2-carboxamide (PubChem CID 163518005) has the molecular formula C26H34N4O3S and a molecular weight of 482.65 g/mol. Its IUPAC name is (2S)-N-[(1S)-3-[4-[3-(2-methoxyethyl)-2-oxo-1,3-benzothiazol-5-yl]phenyl]-1-(methylamino)propyl]piperidine-2-carboxamide.
| Compound Name | (2S)-N-[(1S)-3-[4-[3-(2-methoxyethyl)-2-oxo-1,3-benzothiazol-5-yl]phenyl]-1-(methylamino)propyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 163518005 |
| Molecular Formula | C26H34N4O3S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | (2S)-N-[(1S)-3-[4-[3-(2-methoxyethyl)-2-oxo-1,3-benzothiazol-5-yl]phenyl]-1-(methylamino)propyl]piperidine-2-carboxamide |
| SMILES | CN[C@H](CCc1ccc(-c2ccc3sc(=O)n(CCOC)c3c2)cc1)NC(=O)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C26H34N4O3S/c1-27-24(29-25(31)21-5-3-4-14-28-21)13-8-18-6-9-19(10-7-18)20-11-12-23-22(17-20)30(15-16-33-2)26(32)34-23/h6-7,9-12,17,21,24,27-28H,3-5,8,13-16H2,1-2H3,(H,29,31)/t21-,24-/m0/s1 |
| InChIKey | DIKJDLWSTRVSKI-URXFXBBRSA-N |
| XLogP | 3.11 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|