C14H17N5O5S — CID 163519297
2-amino-9-[(2R,5R)-3-but-3-ynoxy-5-(hydroxymethyl)-4-sulfanyloxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 163519297) has the molecular formula C14H17N5O5S and a molecular weight of 367.39 g/mol. Its IUPAC name is 2-amino-9-[(2R,5R)-3-but-3-ynoxy-5-(hydroxymethyl)-4-sulfanyloxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,5R)-3-but-3-ynoxy-5-(hydroxymethyl)-4-sulfanyloxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 163519297 |
| Molecular Formula | C14H17N5O5S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-amino-9-[(2R,5R)-3-but-3-ynoxy-5-(hydroxymethyl)-4-sulfanyloxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | C#CCCOC1C(OS)[C@@H](CO)O[C@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C14H17N5O5S/c1-2-3-4-22-10-9(24-25)7(5-20)23-13(10)19-6-16-8-11(19)17-14(15)18-12(8)21/h1,6-7,9-10,13,20,25H,3-5H2,(H3,15,17,18,21)/t7-,9?,10?,13-/m1/s1 |
| InChIKey | DJJOCLUYGKMCMC-QQNFCMCUSA-N |
| XLogP | -0.77 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|