C8H22N2O4 — CID 163519877
1,4-diaminobutan-2-ol;2-(2-hydroxyethoxy)ethanol (PubChem CID 163519877) has the molecular formula C8H22N2O4 and a molecular weight of 210.27 g/mol. Its IUPAC name is 1,4-diaminobutan-2-ol;2-(2-hydroxyethoxy)ethanol.
| Compound Name | 1,4-diaminobutan-2-ol;2-(2-hydroxyethoxy)ethanol |
|---|---|
| PubChem CID | 163519877 |
| Molecular Formula | C8H22N2O4 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 1,4-diaminobutan-2-ol;2-(2-hydroxyethoxy)ethanol |
| SMILES | NCCC(O)CN.OCCOCCO |
| InChI | InChI=1S/C4H12N2O.C4H10O3/c5-2-1-4(7)3-6;5-1-3-7-4-2-6/h4,7H,1-3,5-6H2;5-6H,1-4H2 |
| InChIKey | DJWPAJSNFWRCQZ-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|