C20H22N2O4 — CID 163520525
[3-[2-[hydroxy(methoxy)methyl]phenyl]-2H-1,3-benzoxazol-6-yl]-pyrrolidin-1-ylmethanone (PubChem CID 163520525) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is [3-[2-[hydroxy(methoxy)methyl]phenyl]-2H-1,3-benzoxazol-6-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-[2-[hydroxy(methoxy)methyl]phenyl]-2H-1,3-benzoxazol-6-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 163520525 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [3-[2-[hydroxy(methoxy)methyl]phenyl]-2H-1,3-benzoxazol-6-yl]-pyrrolidin-1-ylmethanone |
| SMILES | COC(O)c1ccccc1N1COc2cc(C(=O)N3CCCC3)ccc21 |
| InChI | InChI=1S/C20H22N2O4/c1-25-20(24)15-6-2-3-7-16(15)22-13-26-18-12-14(8-9-17(18)22)19(23)21-10-4-5-11-21/h2-3,6-9,12,20,24H,4-5,10-11,13H2,1H3 |
| InChIKey | DKKKPNRZPVHNTM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|