C18H19N3O2 — CID 163881106
[3-(4-aminophenyl)-2H-1,3-benzoxazol-6-yl]-pyrrolidin-1-ylmethanone (PubChem CID 163881106) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is [3-(4-aminophenyl)-2H-1,3-benzoxazol-6-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-(4-aminophenyl)-2H-1,3-benzoxazol-6-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 163881106 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [3-(4-aminophenyl)-2H-1,3-benzoxazol-6-yl]-pyrrolidin-1-ylmethanone |
| SMILES | Nc1ccc(N2COc3cc(C(=O)N4CCCC4)ccc32)cc1 |
| InChI | InChI=1S/C18H19N3O2/c19-14-4-6-15(7-5-14)21-12-23-17-11-13(3-8-16(17)21)18(22)20-9-1-2-10-20/h3-8,11H,1-2,9-10,12,19H2 |
| InChIKey | PTGRFIPTOBAUAB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|