C51H45N5O — CID 163523233
9-[4-[2-(2,6-dimethylphenyl)phenyl]-2-pyridinyl]-2-[2-methyl-5-[4-(2,3,4,5,6-pentamethylphenyl)-1,2,4-triazol-3-yl]phenoxy]carbazole (PubChem CID 163523233) has the molecular formula C51H45N5O and a molecular weight of 743.96 g/mol. Its IUPAC name is 9-[4-[2-(2,6-dimethylphenyl)phenyl]-2-pyridinyl]-2-[2-methyl-5-[4-(2,3,4,5,6-pentamethylphenyl)-1,2,4-triazol-3-yl]phenoxy]carbazole.
| Compound Name | 9-[4-[2-(2,6-dimethylphenyl)phenyl]-2-pyridinyl]-2-[2-methyl-5-[4-(2,3,4,5,6-pentamethylphenyl)-1,2,4-triazol-3-yl]phenoxy]carbazole |
|---|---|
| PubChem CID | 163523233 |
| Molecular Formula | C51H45N5O |
| Molecular Weight | 743.96 g/mol |
| Exact Mass | 743.36 |
| IUPAC Name | 9-[4-[2-(2,6-dimethylphenyl)phenyl]-2-pyridinyl]-2-[2-methyl-5-[4-(2,3,4,5,6-pentamethylphenyl)-1,2,4-triazol-3-yl]phenoxy]carbazole |
| SMILES | Cc1ccc(-c2nncn2-c2c(C)c(C)c(C)c(C)c2C)cc1Oc1ccc2c3ccccc3n(-c3cc(-c4ccccc4-c4c(C)cccc4C)ccn3)c2c1 |
| InChI | InChI=1S/C51H45N5O/c1-30-20-21-39(51-54-53-29-55(51)50-36(7)34(5)33(4)35(6)37(50)8)26-47(30)57-40-22-23-43-42-17-11-12-19-45(42)56(46(43)28-40)48-27-38(24-25-52-48)41-16-9-10-18-44(41)49-31(2)14-13-15-32(49)3/h9-29H,1-8H3 |
| InChIKey | ZCCCJGOKYDKVBG-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.96 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |