C32H24ClIN2O — CID 166052902
9-(4-chloro-2-pyridinyl)-2-[3-(3-iodo-2,4,6-trimethylphenyl)phenoxy]carbazole (PubChem CID 166052902) has the molecular formula C32H24ClIN2O and a molecular weight of 614.91 g/mol. Its IUPAC name is 9-(4-chloro-2-pyridinyl)-2-[3-(3-iodo-2,4,6-trimethylphenyl)phenoxy]carbazole.
| Compound Name | 9-(4-chloro-2-pyridinyl)-2-[3-(3-iodo-2,4,6-trimethylphenyl)phenoxy]carbazole |
|---|---|
| PubChem CID | 166052902 |
| Molecular Formula | C32H24ClIN2O |
| Molecular Weight | 614.91 g/mol |
| Exact Mass | 614.06 |
| IUPAC Name | 9-(4-chloro-2-pyridinyl)-2-[3-(3-iodo-2,4,6-trimethylphenyl)phenoxy]carbazole |
| SMILES | Cc1cc(C)c(-c2cccc(Oc3ccc4c5ccccc5n(-c5cc(Cl)ccn5)c4c3)c2)c(C)c1I |
| InChI | InChI=1S/C32H24ClIN2O/c1-19-15-20(2)32(34)21(3)31(19)22-7-6-8-24(16-22)37-25-11-12-27-26-9-4-5-10-28(26)36(29(27)18-25)30-17-23(33)13-14-35-30/h4-18H,1-3H3 |
| InChIKey | OULMDRAQNGBYCQ-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.91 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|