About CID 167382638
CID 167382638 (PubChem CID 167382638) has the molecular formula C56H49N4O+
and a molecular weight of 794.04 g/mol.
Molecular Properties
| Compound Name | CID 167382638 |
| PubChem CID | 167382638 |
| Molecular Formula | C56H49N4O+ |
| Molecular Weight | 794.04 g/mol |
| Exact Mass | 793.39 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1-c1cc(Oc2ccc3c4ccccc4n(-c4cc(C(C)(C)C)ccn4)c3c2)cc([N+]23[CH-][N@+]2(c2cccc(-c4c(C)cccc4C)c2)c2ccccc23)c1 |
| InChI | InChI=1S/C56H49N4O/c1-36-15-12-16-37(2)54(36)40-19-14-20-43(29-40)59-35-60(59,52-24-11-10-23-51(52)59)44-30-41(55-38(3)17-13-18-39(55)4)31-46(33-44)61-45-25-26-48-47-21-8-9-22-49(47)58(50(48)34-45)53-32-42(27-28-57-53)56(5,6)7/h8-35H,1-7H3/q+1/t59-,60?/m0/s1 |
| InChIKey | MQKAHEMMGAAOCC-ZOMBOAMHSA-N |
| XLogP | 15.18 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 794.04 |
| LogP ≤ 5 | 15.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 167382638 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167382638?
The IUPAC name of CID 167382638 (CID 167382638) is not available.
What is the SMILES notation for CID 167382638?
The canonical SMILES for CID 167382638 is Cc1cccc(C)c1-c1cc(Oc2ccc3c4ccccc4n(-c4cc(C(C)(C)C)ccn4)c3c2)cc([N+]23[CH-][N@+]2(c2cccc(-c4c(C)cccc4C)c2)c2ccccc23)c1.
What is the InChIKey of CID 167382638?
The InChIKey is MQKAHEMMGAAOCC-ZOMBOAMHSA-N. The full InChI is InChI=1S/C56H49N4O/c1-36-15-12-16-37(2)54(36)40-19-14-20-43(29-40)59-35-60(59,52-24-11-10-23-51(52)59)44-30-41(55-38(3)17-13-18-39(55)4)31-46(33-44)61-45-25-26-48-47-21-8-9-22-49(47)58(50(48)34-45)53-32-42(27-28-57-53)56(5,6)7/h8-35H,1-7H3/q+1/t59-,60?/m0/s1.
What are the key properties of CID 167382638?
CID 167382638 has a molecular weight of 794.04 g/mol, XLogP of 15.18, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167382638 is sourced from PubChem (CID 167382638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).