About CID 167381693
CID 167381693 (PubChem CID 167381693) has the molecular formula C55H63N4O+
and a molecular weight of 796.14 g/mol.
Molecular Properties
| Compound Name | CID 167381693 |
| PubChem CID | 167381693 |
| Molecular Formula | C55H63N4O+ |
| Molecular Weight | 796.14 g/mol |
| Exact Mass | 795.50 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(Oc2ccc3c4ccccc4n(-c4cc(C(C)(C)C(C)(C)C)ccn4)c3c2)cc([N+]23[CH-][N@+]2(c2cccc(C(C)(C)C)c2)c2cc(C(C)(C)C)ccc23)c1 |
| InChI | InChI=1S/C55H63N4O/c1-51(2,3)36-18-17-19-40(28-36)58-35-59(58,48-25-22-37(31-49(48)58)52(4,5)6)41-29-39(53(7,8)9)30-43(33-41)60-42-23-24-45-44-20-15-16-21-46(44)57(47(45)34-42)50-32-38(26-27-56-50)55(13,14)54(10,11)12/h15-35H,1-14H3/q+1/t58-,59?/m0/s1 |
| InChIKey | DLTCXACACDGIRI-MZJDMTOGSA-N |
| XLogP | 15.53 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 796.14 |
| LogP ≤ 5 | 15.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 167381693 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167381693?
The IUPAC name of CID 167381693 (CID 167381693) is not available.
What is the SMILES notation for CID 167381693?
The canonical SMILES for CID 167381693 is CC(C)(C)c1cc(Oc2ccc3c4ccccc4n(-c4cc(C(C)(C)C(C)(C)C)ccn4)c3c2)cc([N+]23[CH-][N@+]2(c2cccc(C(C)(C)C)c2)c2cc(C(C)(C)C)ccc23)c1.
What is the InChIKey of CID 167381693?
The InChIKey is DLTCXACACDGIRI-MZJDMTOGSA-N. The full InChI is InChI=1S/C55H63N4O/c1-51(2,3)36-18-17-19-40(28-36)58-35-59(58,48-25-22-37(31-49(48)58)52(4,5)6)41-29-39(53(7,8)9)30-43(33-41)60-42-23-24-45-44-20-15-16-21-46(44)57(47(45)34-42)50-32-38(26-27-56-50)55(13,14)54(10,11)12/h15-35H,1-14H3/q+1/t58-,59?/m0/s1.
What are the key properties of CID 167381693?
CID 167381693 has a molecular weight of 796.14 g/mol, XLogP of 15.53, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167381693 is sourced from PubChem (CID 167381693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).