About CID 167382076
CID 167382076 (PubChem CID 167382076) has the molecular formula C69H75N4O+
and a molecular weight of 976.39 g/mol.
Molecular Properties
| Compound Name | CID 167382076 |
| PubChem CID | 167382076 |
| Molecular Formula | C69H75N4O+ |
| Molecular Weight | 976.39 g/mol |
| Exact Mass | 975.59 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(C(C)C)c(-c2ccnc(-n3c4ccccc4c4ccc(Oc5cc(C(C)(C)C)cc([N+]67[CH-][N@+]6(c6cc(-c8ccccc8)cc(C(C)(C)C)c6)c6cc(C(C)(C)C)ccc67)c5)cc43)c2)c(C(C)C)c1 |
| InChI | InChI=1S/C69H75N4O/c1-43(2)48-33-59(44(3)4)66(60(34-48)45(5)6)47-29-30-70-65(35-47)71-61-24-20-19-23-57(61)58-27-26-55(41-62(58)71)74-56-38-52(69(13,14)15)37-54(40-56)72-42-73(72,64-39-50(67(7,8)9)25-28-63(64)72)53-32-49(46-21-17-16-18-22-46)31-51(36-53)68(10,11)12/h16-45H,1-15H3/q+1/t72?,73-/m0/s1 |
| InChIKey | QMDMPCVONUPGSR-JWWNQNKGSA-N |
| XLogP | 19.91 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 976.39 |
| LogP ≤ 5 | 19.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 167382076 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167382076?
The IUPAC name of CID 167382076 (CID 167382076) is not available.
What is the SMILES notation for CID 167382076?
The canonical SMILES for CID 167382076 is CC(C)c1cc(C(C)C)c(-c2ccnc(-n3c4ccccc4c4ccc(Oc5cc(C(C)(C)C)cc([N+]67[CH-][N@+]6(c6cc(-c8ccccc8)cc(C(C)(C)C)c6)c6cc(C(C)(C)C)ccc67)c5)cc43)c2)c(C(C)C)c1.
What is the InChIKey of CID 167382076?
The InChIKey is QMDMPCVONUPGSR-JWWNQNKGSA-N. The full InChI is InChI=1S/C69H75N4O/c1-43(2)48-33-59(44(3)4)66(60(34-48)45(5)6)47-29-30-70-65(35-47)71-61-24-20-19-23-57(61)58-27-26-55(41-62(58)71)74-56-38-52(69(13,14)15)37-54(40-56)72-42-73(72,64-39-50(67(7,8)9)25-28-63(64)72)53-32-49(46-21-17-16-18-22-46)31-51(36-53)68(10,11)12/h16-45H,1-15H3/q+1/t72?,73-/m0/s1.
What are the key properties of CID 167382076?
CID 167382076 has a molecular weight of 976.39 g/mol, XLogP of 19.91, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167382076 is sourced from PubChem (CID 167382076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).