About CID 167382401
CID 167382401 (PubChem CID 167382401) has the molecular formula C50H53N4O+
and a molecular weight of 726.00 g/mol.
Molecular Properties
| Compound Name | CID 167382401 |
| PubChem CID | 167382401 |
| Molecular Formula | C50H53N4O+ |
| Molecular Weight | 726.00 g/mol |
| Exact Mass | 725.42 |
| IUPAC Name | — |
| SMILES | CCC(C)(CC)c1ccnc(-n2c3ccccc3c3ccc(Oc4cc(C(C)(C)C)cc([N+]56[CH-][N@+]5(c5cccc(C(C)(C)C)c5)c5ccccc56)c4)cc32)c1 |
| InChI | InChI=1S/C50H53N4O/c1-10-50(9,11-2)35-25-26-51-47(30-35)52-43-20-13-12-19-41(43)42-24-23-39(32-44(42)52)55-40-29-36(49(6,7)8)28-38(31-40)54-33-53(54,45-21-14-15-22-46(45)54)37-18-16-17-34(27-37)48(3,4)5/h12-33H,10-11H2,1-9H3/q+1/t53-,54?/m0/s1 |
| InChIKey | HNHKLQXRTSLMJW-AVRFZLNTSA-N |
| XLogP | 13.98 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 726.00 |
| LogP ≤ 5 | 13.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 167382401 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167382401?
The IUPAC name of CID 167382401 (CID 167382401) is not available.
What is the SMILES notation for CID 167382401?
The canonical SMILES for CID 167382401 is CCC(C)(CC)c1ccnc(-n2c3ccccc3c3ccc(Oc4cc(C(C)(C)C)cc([N+]56[CH-][N@+]5(c5cccc(C(C)(C)C)c5)c5ccccc56)c4)cc32)c1.
What is the InChIKey of CID 167382401?
The InChIKey is HNHKLQXRTSLMJW-AVRFZLNTSA-N. The full InChI is InChI=1S/C50H53N4O/c1-10-50(9,11-2)35-25-26-51-47(30-35)52-43-20-13-12-19-41(43)42-24-23-39(32-44(42)52)55-40-29-36(49(6,7)8)28-38(31-40)54-33-53(54,45-21-14-15-22-46(45)54)37-18-16-17-34(27-37)48(3,4)5/h12-33H,10-11H2,1-9H3/q+1/t53-,54?/m0/s1.
What are the key properties of CID 167382401?
CID 167382401 has a molecular weight of 726.00 g/mol, XLogP of 13.98, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167382401 is sourced from PubChem (CID 167382401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).