About CID 167381870
CID 167381870 (PubChem CID 167381870) has the molecular formula C54H59N4O+
and a molecular weight of 780.09 g/mol.
Molecular Properties
| Compound Name | CID 167381870 |
| PubChem CID | 167381870 |
| Molecular Formula | C54H59N4O+ |
| Molecular Weight | 780.09 g/mol |
| Exact Mass | 779.47 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(Oc2ccc3c4ccccc4n(-c4cc(C(C)(C)C)ccn4)c3c2)cc([N+]23[CH-][N@+]2(c2cc(C4CCCCC4)cc(C(C)(C)C)c2)c2ccccc23)c1 |
| InChI | InChI=1S/C54H59N4O/c1-52(2,3)38-25-26-55-51(32-38)56-47-20-14-13-19-45(47)46-24-23-43(34-48(46)56)59-44-31-40(54(7,8)9)30-42(33-44)58-35-57(58,49-21-15-16-22-50(49)58)41-28-37(36-17-11-10-12-18-36)27-39(29-41)53(4,5)6/h13-16,19-36H,10-12,17-18H2,1-9H3/q+1/t57-,58?/m0/s1 |
| InChIKey | YLMUWLLEXHBMLI-BBRKILIBSA-N |
| XLogP | 15.25 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 780.09 |
| LogP ≤ 5 | 15.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 167381870 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167381870?
The IUPAC name of CID 167381870 (CID 167381870) is not available.
What is the SMILES notation for CID 167381870?
The canonical SMILES for CID 167381870 is CC(C)(C)c1cc(Oc2ccc3c4ccccc4n(-c4cc(C(C)(C)C)ccn4)c3c2)cc([N+]23[CH-][N@+]2(c2cc(C4CCCCC4)cc(C(C)(C)C)c2)c2ccccc23)c1.
What is the InChIKey of CID 167381870?
The InChIKey is YLMUWLLEXHBMLI-BBRKILIBSA-N. The full InChI is InChI=1S/C54H59N4O/c1-52(2,3)38-25-26-55-51(32-38)56-47-20-14-13-19-45(47)46-24-23-43(34-48(46)56)59-44-31-40(54(7,8)9)30-42(33-44)58-35-57(58,49-21-15-16-22-50(49)58)41-28-37(36-17-11-10-12-18-36)27-39(29-41)53(4,5)6/h13-16,19-36H,10-12,17-18H2,1-9H3/q+1/t57-,58?/m0/s1.
What are the key properties of CID 167381870?
CID 167381870 has a molecular weight of 780.09 g/mol, XLogP of 15.25, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167381870 is sourced from PubChem (CID 167381870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).