C14H22BrN5O2 — CID 163523315
methyl N'-[1-[2-(5-bromo-1H-imidazol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamimidate (PubChem CID 163523315) has the molecular formula C14H22BrN5O2 and a molecular weight of 372.27 g/mol. Its IUPAC name is methyl N'-[1-[2-(5-bromo-1H-imidazol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamimidate.
| Compound Name | methyl N'-[1-[2-(5-bromo-1H-imidazol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamimidate |
|---|---|
| PubChem CID | 163523315 |
| Molecular Formula | C14H22BrN5O2 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | methyl N'-[1-[2-(5-bromo-1H-imidazol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamimidate |
| SMILES | CO/C(N)=N\C(C(=O)N1CCCC1c1ncc(Br)[nH]1)C(C)C |
| InChI | InChI=1S/C14H22BrN5O2/c1-8(2)11(19-14(16)22-3)13(21)20-6-4-5-9(20)12-17-7-10(15)18-12/h7-9,11H,4-6H2,1-3H3,(H2,16,19)(H,17,18) |
| InChIKey | DMRVUMYELDIRFC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|