C20H25BrN4O3S2 — CID 59610871
methoxy N-[(2S)-1-[(2S)-2-[5-(5-bromo-3a,6a-dihydrothieno[3,2-b]thiophen-2-yl)-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]methanimidate (PubChem CID 59610871) has the molecular formula C20H25BrN4O3S2 and a molecular weight of 513.48 g/mol. Its IUPAC name is methoxy N-[(2S)-1-[(2S)-2-[5-(5-bromo-3a,6a-dihydrothieno[3,2-b]thiophen-2-yl)-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]methanimidate.
| Compound Name | methoxy N-[(2S)-1-[(2S)-2-[5-(5-bromo-3a,6a-dihydrothieno[3,2-b]thiophen-2-yl)-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]methanimidate |
|---|---|
| PubChem CID | 59610871 |
| Molecular Formula | C20H25BrN4O3S2 |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | methoxy N-[(2S)-1-[(2S)-2-[5-(5-bromo-3a,6a-dihydrothieno[3,2-b]thiophen-2-yl)-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]methanimidate |
| SMILES | COO/C=N/[C@H](C(=O)N1CCC[C@H]1c1ncc(C2=CC3SC(Br)=CC3S2)[nH]1)C(C)C |
| InChI | InChI=1S/C20H25BrN4O3S2/c1-11(2)18(23-10-28-27-3)20(26)25-6-4-5-13(25)19-22-9-12(24-19)14-7-15-16(29-14)8-17(21)30-15/h7-11,13,15-16,18H,4-6H2,1-3H3,(H,22,24)/b23-10+/t13-,15?,16?,18-/m0/s1 |
| InChIKey | OSVNOPKUNRCYKP-PRMHNJIISA-N |
| XLogP | 4.51 |
| TPSA | 79.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|