C15H11F5N2O4 — CID 163524043
ethoxycarbonyl 1-(2,6-difluoro-4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate (PubChem CID 163524043) has the molecular formula C15H11F5N2O4 and a molecular weight of 378.25 g/mol. Its IUPAC name is ethoxycarbonyl 1-(2,6-difluoro-4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate.
| Compound Name | ethoxycarbonyl 1-(2,6-difluoro-4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 163524043 |
| Molecular Formula | C15H11F5N2O4 |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | ethoxycarbonyl 1-(2,6-difluoro-4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)OC(=O)c1cnn(-c2c(F)cc(C)cc2F)c1C(F)(F)F |
| InChI | InChI=1S/C15H11F5N2O4/c1-3-25-14(24)26-13(23)8-6-21-22(12(8)15(18,19)20)11-9(16)4-7(2)5-10(11)17/h4-6H,3H2,1-2H3 |
| InChIKey | DNFFXLJCBKUOLO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|