C8H14O — CID 163525605
(2S)-2,4-dimethyl-6-methylideneoxane (PubChem CID 163525605) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-6-methylideneoxane.
| Compound Name | (2S)-2,4-dimethyl-6-methylideneoxane |
|---|---|
| PubChem CID | 163525605 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2S)-2,4-dimethyl-6-methylideneoxane |
| SMILES | C=C1CC(C)C[C@H](C)O1 |
| InChI | InChI=1S/C8H14O/c1-6-4-7(2)9-8(3)5-6/h6,8H,2,4-5H2,1,3H3/t6?,8-/m0/s1 |
| InChIKey | DOMNSOYKYIWYRD-XDKWHASVSA-N |
| XLogP | 2.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |