C13H18FIN6O — CID 163526059
1-[2-fluoro-4-(3-iodo-2-methyl-1H-pyridazin-6-yl)butyl]-N-methyltriazole-4-carboxamide (PubChem CID 163526059) has the molecular formula C13H18FIN6O and a molecular weight of 420.23 g/mol. Its IUPAC name is 1-[2-fluoro-4-(3-iodo-2-methyl-1H-pyridazin-6-yl)butyl]-N-methyltriazole-4-carboxamide.
| Compound Name | 1-[2-fluoro-4-(3-iodo-2-methyl-1H-pyridazin-6-yl)butyl]-N-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 163526059 |
| Molecular Formula | C13H18FIN6O |
| Molecular Weight | 420.23 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 1-[2-fluoro-4-(3-iodo-2-methyl-1H-pyridazin-6-yl)butyl]-N-methyltriazole-4-carboxamide |
| SMILES | CNC(=O)c1cn(CC(F)CCC2=CC=C(I)N(C)N2)nn1 |
| InChI | InChI=1S/C13H18FIN6O/c1-16-13(22)11-8-21(19-17-11)7-9(14)3-4-10-5-6-12(15)20(2)18-10/h5-6,8-9,18H,3-4,7H2,1-2H3,(H,16,22) |
| InChIKey | DOVZJGIXZFKKBG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|