About US10344025, Example 244
US10344025, Example 244 (PubChem CID 118640594) has the molecular formula C20H22FN7O2
and a molecular weight of 411.40 g/mol. Its IUPAC name is 1-[2-fluoro-4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide.
Molecular Properties
| Compound Name | US10344025, Example 244 |
| PubChem CID | 118640594 |
| Molecular Formula | C20H22FN7O2 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-[2-fluoro-4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide |
| SMILES | CNC(=O)C1=CN(N=N1)CC(CCC2=NN=C(C=C2)NC(=O)CC3=CC=CC=C3)F |
| InChI | InChI=1S/C20H22FN7O2/c1-22-20(30)17-13-28(27-25-17)12-15(21)7-8-16-9-10-18(26-24-16)23-19(29)11-14-5-3-2-4-6-14/h2-6,9-10,13,15H,7-8,11-12H2,1H3,(H,22,30)(H,23,26,29) |
| InChIKey | UJFJCBOEFPHXIT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | 561 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze US10344025, Example 244 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10344025, Example 244?
The IUPAC name of US10344025, Example 244 (CID 118640594) is 1-[2-fluoro-4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide.
What is the SMILES notation for US10344025, Example 244?
The canonical SMILES for US10344025, Example 244 is CNC(=O)C1=CN(N=N1)CC(CCC2=NN=C(C=C2)NC(=O)CC3=CC=CC=C3)F.
What is the InChIKey of US10344025, Example 244?
The InChIKey is UJFJCBOEFPHXIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22FN7O2/c1-22-20(30)17-13-28(27-25-17)12-15(21)7-8-16-9-10-18(26-24-16)23-19(29)11-14-5-3-2-4-6-14/h2-6,9-10,13,15H,7-8,11-12H2,1H3,(H,22,30)(H,23,26,29).
What are the key properties of US10344025, Example 244?
US10344025, Example 244 has a molecular weight of 411.40 g/mol, XLogP of 1.00, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for US10344025, Example 244 is sourced from PubChem (CID 118640594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).