C23H29N7O4 — CID 118646632
1-[4-[6-[[2-[3-(2-methoxyethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide (PubChem CID 118646632) has the molecular formula C23H29N7O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is 1-[4-[6-[[2-[3-(2-methoxyethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide.
| Compound Name | 1-[4-[6-[[2-[3-(2-methoxyethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 118646632 |
| Molecular Formula | C23H29N7O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 1-[4-[6-[[2-[3-(2-methoxyethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide |
| SMILES | CNC(=O)c1cn(CCCCc2ccc(NC(=O)Cc3cccc(OCCOC)c3)nn2)nn1 |
| InChI | InChI=1S/C23H29N7O4/c1-24-23(32)20-16-30(29-27-20)11-4-3-7-18-9-10-21(28-26-18)25-22(31)15-17-6-5-8-19(14-17)34-13-12-33-2/h5-6,8-10,14,16H,3-4,7,11-13,15H2,1-2H3,(H,24,32)(H,25,28,31) |
| InChIKey | BEMFYLFTVLYCIJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|