C19H23N7O2S — CID 157250583
N-methyl-1-[4-[5-[[2-(3-methylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]triazole-4-carboxamide (PubChem CID 157250583) has the molecular formula C19H23N7O2S and a molecular weight of 413.51 g/mol. Its IUPAC name is N-methyl-1-[4-[5-[[2-(3-methylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]triazole-4-carboxamide.
| Compound Name | N-methyl-1-[4-[5-[[2-(3-methylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 157250583 |
| Molecular Formula | C19H23N7O2S |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-methyl-1-[4-[5-[[2-(3-methylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]triazole-4-carboxamide |
| SMILES | CNC(=O)c1cn(CCCCc2nnc(NC(=O)Cc3cccc(C)c3)s2)nn1 |
| InChI | InChI=1S/C19H23N7O2S/c1-13-6-5-7-14(10-13)11-16(27)21-19-24-23-17(29-19)8-3-4-9-26-12-15(22-25-26)18(28)20-2/h5-7,10,12H,3-4,8-9,11H2,1-2H3,(H,20,28)(H,21,24,27) |
| InChIKey | YSBKQKQIPRGIJG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|